Compound Q&A

What are the main uses of 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9)?

Answer

1,4-Naphthalenedicarboxylic acid
1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) is widely utilized in the production of polyesters, such as polyethylene naphthalate (PEN), which are employed in fibers, films, and packaging materials. It also serves as a key intermediate in pharmaceuticals, dyes, and specialty chemicals. Additionally, it is used in research for synthesizing polymers and organic compounds due to its reactivity and structural versatility.

About

CAS No 605-70-9
English Name 1,4-Naphthalenedicarboxylic acid
Molecular Formula C12H8O4
Molecular Weight 216.19 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2C(=O)O)C(=O)O
InChIKey ABMFBCRYHDZLRD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9)?

1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) is a white crystalline organic compound with the ch...

Compound Q&A

Is 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) safe?

1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) is generally considered safe when handled properly....

Compound Q&A

How should 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) be stored?

1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) should be stored in a cool, dry place, preferably a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...