Compound Q&A

What are the main uses of 5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7)?

Answer

5-(4-Bromophenyl)-4,6-dichloropyrimidine
5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) is primarily used in pharmaceutical research as an intermediate for drug development, particularly in compounds targeting metabolic disorders. It also finds applications in agrochemicals and material science due to its reactivity. Its unique structure makes it a key component in synthesizing bioactive molecules and organic compounds for industrial and scientific purposes.

About

English Name 5-(4-Bromophenyl)-4,6-dichloropyrimidine
Molecular Formula C10H5BrCl2N2
Molecular Weight 303.97 g/mol
SMILES Clc1ncnc(c1c1ccc(cc1)Br)Cl
InChIKey WEEFLZORZXLIJE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7)?

5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) is an organic compound with the chemical...

Compound Q&A

Is 5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) safe?

5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) requires careful handling due to potenti...

Compound Q&A

How should 5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) be stored?

5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) should be stored in a cool, dry, and dar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...