Compound Q&A

What is 5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7)?

Answer

5-(4-Bromophenyl)-4,6-dichloropyrimidine
5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) is an organic compound with the chemical formula C10H6BrCl2N2. It is a pyrimidine derivative featuring a 4-bromophenyl group at the 5-position and two chlorine atoms at the 4 and 6 positions. This compound is typically a solid with low solubility in water and is characterized by its halogenated structure, making it valuable in chemical synthesis and research applications.

About

English Name 5-(4-Bromophenyl)-4,6-dichloropyrimidine
Molecular Formula C10H5BrCl2N2
Molecular Weight 303.97 g/mol
SMILES Clc1ncnc(c1c1ccc(cc1)Br)Cl
InChIKey WEEFLZORZXLIJE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7)?

5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) is primarily used in pharmaceutical rese...

Compound Q&A

Is 5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) safe?

5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) requires careful handling due to potenti...

Compound Q&A

How should 5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) be stored?

5-(4-Bromophenyl)-4,6-dichloropyrimidine (CAS: 146533-41-7) should be stored in a cool, dry, and dar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...