4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide(CAS: 757251-39-1)

CAS Number
Related Products
4-Chloro-2-pyridinecarboxamide
CAS Number: 99586-65-9
Sodium benzenethiolate
CAS Number: 930-69-8
Other Suppliers for 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide
Basic Information
Molecular Formula
C13H12FN3O2
Molecular Weight
261.26 g/mol
Physical Properties
Melting Point
141.0 to 145.0 deg-C
Density
1.305
Chemical Identifiers
SMILES
CNC(=O)c1nccc(c1)Oc1ccc(c(c1)F)N
InChIKey
ZQHJPIPGBODVTG-UHFFFAOYSA-N
Database References
MDL Number
MFCD09033852
FAQ
4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) is a chemical compound containing a picolinamide group linked to a 4-amino-3-fluorophenoxy moiety. It is characterized by its molecular structure, which includes an aromatic ring with fluorine and amino substituents, making it relevant in pharmaceutical and chemical research. The compound is known for its potential biological activity and is often studied for its applications in drug development.
4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) is primarily used in pharmaceutical research as a potential lead compound for drug development. It may serve as an intermediate in the synthesis of various bioactive molecules. Additionally, it finds applications in chemical synthesis and can be relevant in studies related to medicinal chemistry and organic reactions.
The safety of 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) depends on its specific application and exposure conditions. It is generally considered safe when handled properly in controlled environments. However, standard safety precautions should be followed, including the use of protective equipment and ensuring proper ventilation. Safety data sheets (SDS) should be consulted for detailed handling guidelines.
4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) should be stored in a cool, dry, and well-ventilated place, away from light and moisture. It is typically kept in a sealed container to maintain its stability. Storage conditions should be maintained at a temperature below 25°C and humidity levels below 60% to prevent degradation and ensure long-term integrity.
Safety Notice
Please verify product specifications and safety data before use. Contact the supplier for detailed safety information.
Always follow proper handling procedures



![4-[4-({[4-Chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)-3-fluorophenoxy]-N-methyl-2-pyridinecarboxamide](https://static.chemtradehub.com/structs/755/755037-03-7-d9bc.webp)



