2,5-dihydrofuran-3-carboxylic acid | CAS No. 1002728-73-5

2,5-dihydrofuran-3-carboxylic acid

Basic Information

CAS Number

1002728-73-5

Molecular Formula

C5H6O3

Molecular Weight

114.1 g/mol

AD

Basic Physical Properties

OC(=O)C1=CCOC1

InChI

InChI=1S/C5H6O3/c6-5(7)4-1-2-8-3-4/h1H,2-3H2,(H,6,7)

InChIKey

VGPHHRYBFDWNMV-UHFFFAOYSA-N

LogP

0.02760000000000007

Topological Polar Surface Area

46.53 Ų

Hydrogen Bond Donor/Acceptor

1 / 3

Synonyms & References

English

  • 2,?5-?dihydro-3-?Furancarboxylic acid
  • 2,5-dihydrofuran-3-carboxylic acid

MDL Number

MFCD19231792

FAQ

What are the physical and chemical properties of 2,5-dihydrofuran-3-carboxylic acid (CAS: 1002728-73-5)?

2,5-Dihydrofuran-3-carboxylic acid is a white crystalline solid with a molecular weight of approximately 124.1 g/mol. It has a pKa of about 4.7. This compound is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. It is a weak acid and reacts easily with bases to form its sodium or potassium salts.

How is 2,5-dihydrofuran-3-carboxylic acid (CAS: 1002728-73-5) typically synthesized?

2,5-Dihydrofuran-3-carboxylic acid can be synthesized via the condensation of 2,5-dihydrofuran with acetic anhydride, followed by hydrolysis. Other methods include the reaction of 2,5-dihydrofuran with carboxylic acid chlorides or anhydrides, yielding a higher yield and selectivity. These reactions are commonly catalyzed by acid or base promoters.

What industries use 2,5-dihydrofuran-3-carboxylic acid (CAS: 1002728-73-5)?

2,5-Dihydrofuran-3-carboxylic acid is primarily used in the pharmaceutical and polymer industries. It serves as a precursor for the synthesis of various drugs and is also utilized in the production of polymeric materials. Additionally, it finds applications in the sensing and semiconductor industries due to its chemical reactivity.

What precautions should be taken when handling 2,5-dihydrofuran-3-carboxylic acid (CAS: 1002728-73-5)?

When handling 2,5-dihydrofuran-3-carboxylic acid, it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area or under a fume hood to minimize exposure to air. Spills should be cleaned up using appropriate absorbent materials, and proper waste disposal procedures should be followed. Always consult the Safety Data Sheet (SDS) for detailed safety information.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...