Compound Q&A

What are the main uses of (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid (CAS: 80434-32-8)?

Answer

(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid
(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of other bile acid derivatives. It is also utilized in some research applications for studying bile acid metabolism and related physiological functions.

About

CAS No 80434-32-8
English Name (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid
Molecular Formula C24H40O5
Molecular Weight 408.58 g/mol
SMILES C[C@H](CCC(O)=O)C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC(O)[C@]4(C)[C@H]3C[C@H](O)[C@]12C
InChIKey DAKYVYUAVGJDRK-FPUZENINSA-N
Last Updated: 2026-04-03 12:52

Related Q&A

Compound Q&A

What is (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid (CAS: 80434-32-8)?

(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid is a steroidal acid with the CAS nu...

Compound Q&A

Is (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid (CAS: 80434-32-8) safe?

(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid is generally considered safe when h...

Compound Q&A

How should (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid (CAS: 80434-32-8) be stored?

(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...