Compound Q&A

What is (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid (CAS: 80434-32-8)?

Answer

(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid
(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid is a steroidal acid with the CAS number 80434-32-8. It is a naturally occurring compound that belongs to the cholate group of bile acids, characterized by its three hydroxyl groups and the 24-carboxylic acid function. This compound is typically colorless and is soluble in organic solvents.

About

CAS No 80434-32-8
English Name (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid
Molecular Formula C24H40O5
Molecular Weight 408.58 g/mol
SMILES C[C@H](CCC(O)=O)C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC(O)[C@]4(C)[C@H]3C[C@H](O)[C@]12C
InChIKey DAKYVYUAVGJDRK-FPUZENINSA-N
Last Updated: 2026-04-03 12:52

Related Q&A

Compound Q&A

What are the main uses of (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid (CAS: 80434-32-8)?

(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid is primarily used in the pharmaceut...

Compound Q&A

Is (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid (CAS: 80434-32-8) safe?

(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid is generally considered safe when h...

Compound Q&A

How should (1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid (CAS: 80434-32-8) be stored?

(1beta,3alpha,5beta,12alpha)-1,3,12-Trihydroxycholan-24-oic acid should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...