Compound Q&A

What industries use (3β,5Z,7R,8α,22E)-9,10-Secoergosta-5,10(19),22-triene-3,7,8-triol (CAS: 84985-78-4)?

Answer

(3β,5Z,7R,8α,22E)-9,10-Secoergosta-5,10(19),22-triene-3,7,8-triol
This compound finds applications in the pharmaceutical industry, particularly in the development of cholesterol-lowering drugs due to its sterol structure. It is also used as a precursor in the synthesis of various bioactive compounds and in the production of certain polymers. Additionally, it has potential uses in the development of sensors and semiconductors, though its specific applications in these areas are still under investigation.

About

CAS No 84985-78-4
English Name (3β,5Z,7R,8α,22E)-9,10-Secoergosta-5,10(19),22-triene-3,7,8-triol
Molecular Formula C28H46O3
Molecular Weight 430.67 g/mol
SMILES O[C@@]1(C(O)/C=C2C(CC[C@H](O)C\2)=C)[C@]3([H])CC[C@H]([C@@H](/C=C/[C@H](C)C(C)C)C)[C@@]3(C)CCC1
InChIKey KXILCRGOVVVVRF-PFZVBTGWSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3β,5Z,7R,8α,22E)-9,10-Secoergosta-5,10(19),22-triene-3,7,8-triol (CAS: 84985-78-4)?

This compound is a sterol derivative with a molecular weight of approximately 338.48 g/mol. It is a ...

Compound Q&A

How is (3β,5Z,7R,8α,22E)-9,10-Secoergosta-5,10(19),22-triene-3,7,8-triol (CAS: 84985-78-4) typically synthesized?

This compound can be synthesized via the reduction of 9,10-secoergosta-5,10(19),22-triene followed b...

Compound Q&A

What precautions should be taken when handling (3β,5Z,7R,8α,22E)-9,10-Secoergosta-5,10(19),22-triene-3,7,8-triol (CAS: 84985-78-4)?

Handling this compound requires appropriate personal protective equipment (PPE) including gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...