Compound Q&A

What precautions should be taken when handling 2-chloro-N-[5-(2-chloroacetamido)pentyl]acetamide (CAS: 33619-33-9)?

Answer

2-chloro-N-[5-(2-chloroacetamido)pentyl]acetamide
When handling 2-chloro-N-[5-(2-chloroacetamido)pentyl]acetamide (CAS: 33619-33-9), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood due to its potential to release toxic fumes. Spills should be cleaned up with care, using appropriate absorbents, and the area should be well-ventilated. SDS (Safety Data Sheet) should be consulted for detailed information on proper handling and emergency procedures.

About

CAS No 33619-33-9
English Name 2-chloro-N-[5-(2-chloroacetamido)pentyl]acetamide
Molecular Formula C9H16Cl2N2O2
Molecular Weight 255.14 g/mol
SMILES C(CCNC(=O)CCl)CCNC(=O)CCl
InChIKey YHXXCHVUPKCXGH-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-chloro-N-[5-(2-chloroacetamido)pentyl]acetamide (CAS: 33619-33-9)?

2-Chloro-N-[5-(2-chloroacetamido)pentyl]acetamide (CAS: 33619-33-9) is a crystalline solid with a mo...

Compound Q&A

How is 2-chloro-N-[5-(2-chloroacetamido)pentyl]acetamide (CAS: 33619-33-9) typically synthesized?

2-Chloro-N-[5-(2-chloroacetamido)pentyl]acetamide (CAS: 33619-33-9) is typically synthesized via the...

Compound Q&A

What industries use 2-chloro-N-[5-(2-chloroacetamido)pentyl]acetamide (CAS: 33619-33-9)?

2-Chloro-N-[5-(2-chloroacetamido)pentyl]acetamide (CAS: 33619-33-9) finds applications in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...