Compound Q&A

What precautions should be taken when handling (5-Chloro-1H-indol-2-yl)boronic acid (CAS: 282528-62-5)?

Answer

(5-Chloro-1H-indol-2-yl)boronic acid
When handling (5-Chloro-1H-indol-2-yl)boronic acid, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure to the compound. Spills should be cleaned up immediately using appropriate cleaning agents, and spills should be reported to the safety officer. Always consult the Material Safety Data Sheet (MSDS) for additional safety information.

About

English Name (5-Chloro-1H-indol-2-yl)boronic acid
Molecular Formula C8H7BClNO2
Molecular Weight 195.41 g/mol
SMILES B(C1=CC2=C(N1)C=CC(=C2)Cl)(O)O
InChIKey IDVLNSZYFCBHNS-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Chloro-1H-indol-2-yl)boronic acid (CAS: 282528-62-5)?

(5-Chloro-1H-indol-2-yl)boronic acid is a crystalline solid with a molecular weight of approximately...

Compound Q&A

How is (5-Chloro-1H-indol-2-yl)boronic acid (CAS: 282528-62-5) typically synthesized?

(5-Chloro-1H-indol-2-yl)boronic acid is commonly synthesized through a two-step process. First, (5-C...

Compound Q&A

What industries use (5-Chloro-1H-indol-2-yl)boronic acid (CAS: 282528-62-5)?

(5-Chloro-1H-indol-2-yl)boronic acid is predominantly used in the pharmaceutical industry for the sy...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...