Compound Q&A

How is (5-Chloro-1H-indol-2-yl)boronic acid (CAS: 282528-62-5) typically synthesized?

Answer

(5-Chloro-1H-indol-2-yl)boronic acid
(5-Chloro-1H-indol-2-yl)boronic acid is commonly synthesized through a two-step process. First, (5-Chloro-2-indolyl)boronic acid can be prepared from 5-chloroindole using a boronic anhydride. Second, this intermediate undergoes a Suzuki coupling reaction with a boronic acid or ester under the presence of a palladium catalyst. The yield is typically high, and the method is highly selective.

About

English Name (5-Chloro-1H-indol-2-yl)boronic acid
Molecular Formula C8H7BClNO2
Molecular Weight 195.41 g/mol
SMILES B(C1=CC2=C(N1)C=CC(=C2)Cl)(O)O
InChIKey IDVLNSZYFCBHNS-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Chloro-1H-indol-2-yl)boronic acid (CAS: 282528-62-5)?

(5-Chloro-1H-indol-2-yl)boronic acid is a crystalline solid with a molecular weight of approximately...

Compound Q&A

What industries use (5-Chloro-1H-indol-2-yl)boronic acid (CAS: 282528-62-5)?

(5-Chloro-1H-indol-2-yl)boronic acid is predominantly used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling (5-Chloro-1H-indol-2-yl)boronic acid (CAS: 282528-62-5)?

When handling (5-Chloro-1H-indol-2-yl)boronic acid, it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...