Compound Q&A

What industries use 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2)?

Answer

4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid
4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those requiring aromatic nitrogen heterocycles. It is also used in polymer synthesis as an intermediate, in the development of sensors, and in the production of some electronic materials due to its aromatic structure.

About

English Name 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid
Molecular Formula C13H8FNO4
Molecular Weight 261.2053 g/mol
SMILES C1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)F)[N+](=O)[O-]
InChIKey TXSMMXNGTYCZST-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2)?

4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) is a solid with a crystalline form....

Compound Q&A

How is 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) typically synthesized?

4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) is typically synthesized via the ni...

Compound Q&A

What precautions should be taken when handling 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2)?

When handling 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2), it is essential to u...

Compound Q&A

Is 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) safe?

The safety of 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) depends on...

530081-57-31-[(4-Bromophenyl)su...
Compound Q&A

What are the physical and chemical properties of 1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2)?

1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2) is a solid with a crystalli...

5905-36-21-N,3-N-diphenylbenz...
Compound Q&A

Is 2-Methyl-2-nitropropane (CAS: 594-70-7) safe?

2-Methyl-2-nitropropane is generally safe when handled with appropriate precauti...

594-70-72-Methyl-2-nitroprop...
Compound Q&A

How should waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) be handled?

Waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) ...

886501-77-51-(2,3-Difluoro-6-me...