Compound Q&A

What are the physical and chemical properties of 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2)?

Answer

4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid
4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) is a solid with a crystalline form. Its molecular weight is approximately 296.06 g/mol. This compound has low water solubility and moderate solubility in organic solvents. It exhibits high reactivity towards nucleophiles and can undergo substitution reactions. Chemically, it is stable under normal laboratory conditions but is sensitive to reducing agents.

About

English Name 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid
Molecular Formula C13H8FNO4
Molecular Weight 261.2053 g/mol
SMILES C1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)F)[N+](=O)[O-]
InChIKey TXSMMXNGTYCZST-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

How is 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) typically synthesized?

4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) is typically synthesized via the ni...

Compound Q&A

What industries use 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2)?

4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) is used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2)?

When handling 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2), it is essential to u...

Compound Q&A

Is 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) safe?

The safety of 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) depends on...

530081-57-31-[(4-Bromophenyl)su...
Compound Q&A

What are the physical and chemical properties of 1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2)?

1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2) is a solid with a crystalli...

5905-36-21-N,3-N-diphenylbenz...
Compound Q&A

Is 2-Methyl-2-nitropropane (CAS: 594-70-7) safe?

2-Methyl-2-nitropropane is generally safe when handled with appropriate precauti...

594-70-72-Methyl-2-nitroprop...
Compound Q&A

How should waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) be handled?

Waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) ...

886501-77-51-(2,3-Difluoro-6-me...