Compound Q&A

How is 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) typically synthesized?

Answer

4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid
4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) is typically synthesized via the nitration of 4'-fluorobiphenyl followed by carboxylation. Commonly used reagents include nitric acid and sulfuric acid for nitration, and carboxylation is achieved using carbon dioxide. The yield is generally around 70-80%.

About

English Name 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid
Molecular Formula C13H8FNO4
Molecular Weight 261.2053 g/mol
SMILES C1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)F)[N+](=O)[O-]
InChIKey TXSMMXNGTYCZST-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2)?

4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) is a solid with a crystalline form....

Compound Q&A

What industries use 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2)?

4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2) is used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2)?

When handling 4'-Fluoro-3'-nitrobiphenyl-3-carboxylic acid (CAS: 1280786-72-2), it is essential to u...

Compound Q&A

Is 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) safe?

The safety of 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) depends on...

530081-57-31-[(4-Bromophenyl)su...
Compound Q&A

What are the physical and chemical properties of 1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2)?

1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2) is a solid with a crystalli...

5905-36-21-N,3-N-diphenylbenz...
Compound Q&A

Is 2-Methyl-2-nitropropane (CAS: 594-70-7) safe?

2-Methyl-2-nitropropane is generally safe when handled with appropriate precauti...

594-70-72-Methyl-2-nitroprop...
Compound Q&A

How should waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) be handled?

Waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) ...

886501-77-51-(2,3-Difluoro-6-me...