Compound Q&A

What industries use Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5)?

Answer

Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (1:1)
Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5) is used in pharmaceuticals for its anti-inflammatory and antioxidant properties, in polymers for enhancing material properties, and in sensors for its sensitivity to various analytes. It also finds applications in semiconductor manufacturing due to its electronic properties.

About

CAS No 6381-91-5
English Name Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (1:1)
Molecular Formula C14H10CaN2O7S2
Molecular Weight 422.45 g/mol
SMILES c1ccc2c(c1)C(=O)N(S2(=O)=O)[Ca]N3C(=O)c4ccccc4S3(=O)=O.O
InChIKey MQRKKLAGBPVXCD-UHFFFAOYSA-L
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5)?

Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5) is a crystalline co...

Compound Q&A

How is Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5) typically synthesized?

Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5) is synthesized thro...

Compound Q&A

What precautions should be taken when handling Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5)?

When handling Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5), wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...