Compound Q&A

What are the physical and chemical properties of Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5)?

Answer

Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (1:1)
Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5) is a crystalline compound with a high molecular weight and moderate solubility in water. It exhibits good reactivity with acidic substances. The hydrate form adds stability but reduces its solubility. It has a melting point of around 300°C and is stable under normal laboratory conditions.

About

CAS No 6381-91-5
English Name Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (1:1)
Molecular Formula C14H10CaN2O7S2
Molecular Weight 422.45 g/mol
SMILES c1ccc2c(c1)C(=O)N(S2(=O)=O)[Ca]N3C(=O)c4ccccc4S3(=O)=O.O
InChIKey MQRKKLAGBPVXCD-UHFFFAOYSA-L
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

How is Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5) typically synthesized?

Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5) is synthesized thro...

Compound Q&A

What industries use Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5)?

Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5) is used in pharmace...

Compound Q&A

What precautions should be taken when handling Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5)?

When handling Bis(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)calcium hydrate (CAS: 6381-91-5), wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...