Compound Q&A

What are the physical and chemical properties of N-(3,4-Dimethoxyphenyl)acetamide (CAS: 881-70-9)?

Answer

N-(3,4-Dimethoxyphenyl)acetamide
N-(3,4-Dimethoxyphenyl)acetamide (CAS: 881-70-9) is a white to off-white crystalline solid with a molecular weight of approximately 218.17 g/mol. It has a pKa of around 10.2. The compound is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. It is chemically stable but can react with strong bases and acids to form amine and carboxylic acid derivatives. It is also known to undergo hydrolysis under basic conditions.

About

CAS No 881-70-9
English Name N-(3,4-Dimethoxyphenyl)acetamide
Molecular Formula C10H13NO3
Molecular Weight 195.22 g/mol
SMILES CC(=O)NC1=CC(=C(C=C1)OC)OC
InChIKey DZPYVOWPTBVRJR-UHFFFAOYSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

How is N-(3,4-Dimethoxyphenyl)acetamide (CAS: 881-70-9) typically synthesized?

N-(3,4-Dimethoxyphenyl)acetamide (CAS: 881-70-9) can be synthesized by the reaction of 3,4-dimethoxy...

Compound Q&A

What industries use N-(3,4-Dimethoxyphenyl)acetamide (CAS: 881-70-9)?

N-(3,4-Dimethoxyphenyl)acetamide (CAS: 881-70-9) is predominantly used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling N-(3,4-Dimethoxyphenyl)acetamide (CAS: 881-70-9)?

When handling N-(3,4-Dimethoxyphenyl)acetamide (CAS: 881-70-9), it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...