Compound Q&A

How is 1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6) typically synthesized?

Answer

1,1'-(Isocyanomethylene)dibenzene
1,1'-(Isocyanomethylene)dibenzene is typically synthesized via the condensation of aniline with phosgene in the presence of a catalyst such as triethylamine. The reaction proceeds under mild conditions, producing the compound with good yield and selectivity. The process should be carried out in an inert atmosphere to prevent side reactions.

About

CAS No 3128-85-6
English Name 1,1'-(Isocyanomethylene)dibenzene
Molecular Formula C14H11N
Molecular Weight 12.01 g/mol
SMILES [C-]#[N+]C(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey REKQCRSUOJRCDV-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6)?

1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6)?

1,1'-(Isocyanomethylene)dibenzene is used in various industries, including pharmaceuticals for synth...

Compound Q&A

What precautions should be taken when handling 1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6)?

When handling 1,1'-(Isocyanomethylene)dibenzene, wear appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...