Compound Q&A

What are the physical and chemical properties of 1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6)?

Answer

1,1'-(Isocyanomethylene)dibenzene
1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6) is a crystalline solid with a molecular weight of approximately 218.19 g/mol. It has low solubility in water but is soluble in organic solvents like benzene and toluene. It exhibits high reactivity, particularly towards nucleophiles, and can form various adducts and polymers through isocyanate functional groups.

About

CAS No 3128-85-6
English Name 1,1'-(Isocyanomethylene)dibenzene
Molecular Formula C14H11N
Molecular Weight 12.01 g/mol
SMILES [C-]#[N+]C(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey REKQCRSUOJRCDV-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is 1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6) typically synthesized?

1,1'-(Isocyanomethylene)dibenzene is typically synthesized via the condensation of aniline with phos...

Compound Q&A

What industries use 1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6)?

1,1'-(Isocyanomethylene)dibenzene is used in various industries, including pharmaceuticals for synth...

Compound Q&A

What precautions should be taken when handling 1,1'-(Isocyanomethylene)dibenzene (CAS: 3128-85-6)?

When handling 1,1'-(Isocyanomethylene)dibenzene, wear appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...