Compound Q&A

How is 3-Demethyl Colchicine-d3 (CAS: 1314417-96-3) typically synthesized?

Answer

3-Demethyl Colchicine-d3
3-Demethyl Colchicine-d3 is synthesized through a series of chemical reactions starting from colchicine. The process involves demethylation using a strong base like sodium methoxide. The reaction is carried out in an anhydrous organic solvent at low temperature. The yield is around 70%, and the method requires careful control of reaction conditions to achieve high selectivity.

About

English Name 3-Demethyl Colchicine-d3
Molecular Formula C21H23NO6
Molecular Weight 385.41 g/mol
SMILES CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)O
InChIKey JRRUSQGIRBEMRN-VSLDJYOXSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Demethyl Colchicine-d3 (CAS: 1314417-96-3)?

3-Demethyl Colchicine-d3 (CAS: 1314417-96-3) is a white crystalline solid. It has a molecular weight...

Compound Q&A

What industries use 3-Demethyl Colchicine-d3 (CAS: 1314417-96-3)?

3-Demethyl Colchicine-d3 (CAS: 1314417-96-3) is primarily used in the pharmaceutical industry for re...

Compound Q&A

What precautions should be taken when handling 3-Demethyl Colchicine-d3 (CAS: 1314417-96-3)?

When handling 3-Demethyl Colchicine-d3 (CAS: 1314417-96-3), it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...