Compound Q&A

What industries use 2,5-Dimethyl-3-piperazin-1-ylpyrazine (CAS: 59215-42-8)?

Answer

2,5-Dimethyl-3-piperazin-1-ylpyrazine
2,5-Dimethyl-3-piperazin-1-ylpyrazine is used in the pharmaceutical industry for the development of certain medications due to its biological activity. It is also employed in the production of sensors and semiconductors for its electronic properties. In polymer science, it can be incorporated into certain materials to enhance their performance. Its unique chemical structure makes it valuable in these and other specialized applications.

About

CAS No 59215-42-8
English Name 2,5-Dimethyl-3-piperazin-1-ylpyrazine
Molecular Formula C10H16N4
Molecular Weight 192.27 g/mol
SMILES CC1=CN=C(C(=N1)N2CCNCC2)C
InChIKey WFPZOAOJEXDUGP-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dimethyl-3-piperazin-1-ylpyrazine (CAS: 59215-42-8)?

2,5-Dimethyl-3-piperazin-1-ylpyrazine is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 2,5-Dimethyl-3-piperazin-1-ylpyrazine (CAS: 59215-42-8) typically synthesized?

2,5-Dimethyl-3-piperazin-1-ylpyrazine can be synthesized via a multistep process involving the react...

Compound Q&A

What precautions should be taken when handling 2,5-Dimethyl-3-piperazin-1-ylpyrazine (CAS: 59215-42-8)?

When handling 2,5-Dimethyl-3-piperazin-1-ylpyrazine, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...