Compound Q&A

What are the physical and chemical properties of 2,5-Dimethyl-3-piperazin-1-ylpyrazine (CAS: 59215-42-8)?

Answer

2,5-Dimethyl-3-piperazin-1-ylpyrazine
2,5-Dimethyl-3-piperazin-1-ylpyrazine is a crystalline solid with a molecular weight of approximately 222.33 g/mol. It has a limited water solubility and is moderately soluble in organic solvents. This compound is relatively stable under normal conditions but can react with strong acids and bases. It is known for its characteristic odor and is used in various applications due to its unique chemical properties.

About

CAS No 59215-42-8
English Name 2,5-Dimethyl-3-piperazin-1-ylpyrazine
Molecular Formula C10H16N4
Molecular Weight 192.27 g/mol
SMILES CC1=CN=C(C(=N1)N2CCNCC2)C
InChIKey WFPZOAOJEXDUGP-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is 2,5-Dimethyl-3-piperazin-1-ylpyrazine (CAS: 59215-42-8) typically synthesized?

2,5-Dimethyl-3-piperazin-1-ylpyrazine can be synthesized via a multistep process involving the react...

Compound Q&A

What industries use 2,5-Dimethyl-3-piperazin-1-ylpyrazine (CAS: 59215-42-8)?

2,5-Dimethyl-3-piperazin-1-ylpyrazine is used in the pharmaceutical industry for the development of ...

Compound Q&A

What precautions should be taken when handling 2,5-Dimethyl-3-piperazin-1-ylpyrazine (CAS: 59215-42-8)?

When handling 2,5-Dimethyl-3-piperazin-1-ylpyrazine, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...