Compound Q&A

What are the physical and chemical properties of 3-(2-Naphthyloxy)azetidine (CAS: 784123-27-9)?

Answer

3-(2-Naphthyloxy)azetidine
3-(2-Naphthyloxy)azetidine is a crystalline compound with a molecular weight of approximately 212.26 g/mol. It has a high solubility in organic solvents like methanol and ethanol but is poorly soluble in water. The compound is moderately reactive, particularly towards nucleophilic substitution reactions. It exhibits good stability under normal storage conditions but requires protection from moisture and light.

About

English Name 3-(2-Naphthyloxy)azetidine
Molecular Formula C13H13NO
Molecular Weight 199.25 g/mol
SMILES C1C(CN1)OC2=CC3=CC=CC=C3C=C2
InChIKey ZQXUEIDHHHQAEN-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is 3-(2-Naphthyloxy)azetidine (CAS: 784123-27-9) typically synthesized?

3-(2-Naphthyloxy)azetidine can be synthesized via a multistep process involving the coupling of a na...

Compound Q&A

What industries use 3-(2-Naphthyloxy)azetidine (CAS: 784123-27-9)?

3-(2-Naphthyloxy)azetidine is primarily used in the pharmaceutical industry for the synthesis of bio...

Compound Q&A

What precautions should be taken when handling 3-(2-Naphthyloxy)azetidine (CAS: 784123-27-9)?

When handling 3-(2-Naphthyloxy)azetidine, it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...