Compound Q&A

What precautions should be taken when handling (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate (CAS: 681034-14-0)?

Answer

(+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate
When handling (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate, it is essential to work in a well-ventilated area and use appropriate personal protective equipment (PPE) such as gloves and safety glasses. Ensure the use of a fume hood to minimize exposure. If a spill occurs, immediately clean it up using appropriate absorbent materials and follow the safety data sheet (SDS) for disposal instructions. Store the compound in a cool, dry place and avoid contact with water or acids.

About

English Name (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate
Molecular Formula C10H21NO3S2
Molecular Weight 267.42 g/mol
SMILES CC1(CC(C(N1O)(C)C)COS(=O)(=S)C)C
InChIKey WRGRMWJGHAOGQV-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate (CAS: 681034-14-0)?

The physical properties of (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonat...

Compound Q&A

How is (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate (CAS: 681034-14-0) typically synthesized?

The synthesis of (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate is often...

Compound Q&A

What industries use (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate (CAS: 681034-14-0)?

This compound is primarily used in the pharmaceutical industry for its antioxidant properties and as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...