Compound Q&A

What are the physical and chemical properties of (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate (CAS: 681034-14-0)?

Answer

(+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate
The physical properties of (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate include a crystalline form and a molecular weight of approximately 320.4 g/mol. It has moderate solubility in common organic solvents like dichloromethane and poor solubility in water. Reactivity is low under normal conditions but can exhibit nucleophilic substitution under specific conditions. This compound is stable at room temperature but should be stored in a cool, dry place to maintain its integrity.

About

English Name (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate
Molecular Formula C10H21NO3S2
Molecular Weight 267.42 g/mol
SMILES CC1(CC(C(N1O)(C)C)COS(=O)(=S)C)C
InChIKey WRGRMWJGHAOGQV-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

How is (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate (CAS: 681034-14-0) typically synthesized?

The synthesis of (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate is often...

Compound Q&A

What industries use (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate (CAS: 681034-14-0)?

This compound is primarily used in the pharmaceutical industry for its antioxidant properties and as...

Compound Q&A

What precautions should be taken when handling (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate (CAS: 681034-14-0)?

When handling (+)-(1-Oxyl-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl Methanethiosulfonate, it is esse...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...