Compound Q&A

How is 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 81929-44-4) typically synthesized?

Answer

4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate
4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate is synthesized through a multistep process involving the reaction of 4-pentylphenol with 4-(trans-4-pentylcyclohexyl)benzoic acid. Commonly, this involves esterification under acidic conditions, followed by purification steps such as recrystallization. The process typically yields a product with high purity and selectivity, although specific yield and purity can vary depending on the conditions.

About

CAS No 81929-44-4
English Name 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate
Molecular Formula C29H40O2
Molecular Weight 420.64 g/mol
SMILES CCCCCC1CCC(CC1)C2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)CCCCC
InChIKey ILPSJDLONAPDJJ-ALOJWSFFSA-N
Last Updated: 2026-04-01 08:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 81929-44-4)?

4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate is a crystalline compound with a molecular weigh...

Compound Q&A

What industries use 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 81929-44-4)?

4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate is primarily used in the fragrance and flavor in...

Compound Q&A

What precautions should be taken when handling 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 81929-44-4)?

When handling 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...