Compound Q&A

What are the physical and chemical properties of 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 81929-44-4)?

Answer

4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate
4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate is a crystalline compound with a molecular weight of approximately 378.5 g/mol. It has a low solubility in water but is soluble in common organic solvents such as ethanol and acetone. Chemically, it is relatively stable but can react with strong acids and bases. It has a melting point of around 75-77°C and a boiling point of approximately 320-325°C. This compound is typically used in the production of fragrances and as a flavoring agent in foods.

About

CAS No 81929-44-4
English Name 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate
Molecular Formula C29H40O2
Molecular Weight 420.64 g/mol
SMILES CCCCCC1CCC(CC1)C2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)CCCCC
InChIKey ILPSJDLONAPDJJ-ALOJWSFFSA-N
Last Updated: 2026-04-01 08:55

Related Q&A

Compound Q&A

How is 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 81929-44-4) typically synthesized?

4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate is synthesized through a multistep process invol...

Compound Q&A

What industries use 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 81929-44-4)?

4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate is primarily used in the fragrance and flavor in...

Compound Q&A

What precautions should be taken when handling 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 81929-44-4)?

When handling 4-Pentylphenyl 4-(trans-4-pentylcyclohexyl)benzoate, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...