Compound Q&A

What industries use 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (CAS: 879669-95-1)?

Answer

2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (1:1)
2-(Methylamino)-1-phenyl-1-pentanone hydrochloride is used in the pharmaceutical industry as an intermediate or potential drug candidate due to its functional groups. It also has applications in the chemical industry for the synthesis of various organic compounds. Additionally, it can be used in analytical chemistry for sensing applications due to its reactivity.

About

English Name 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (1:1)
Molecular Formula C12H18ClNO
Molecular Weight 227.74 g/mol
SMILES CCCC(C(=O)C1=CC=CC=C1)NC.Cl
InChIKey MACVVBRQAPNUKT-UHFFFAOYSA-N
Last Updated: 2026-04-01 03:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (CAS: 879669-95-1)?

2-(Methylamino)-1-phenyl-1-pentanone hydrochloride is a white crystalline solid. Its molecular weigh...

Compound Q&A

How is 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (CAS: 879669-95-1) typically synthesized?

2-(Methylamino)-1-phenyl-1-pentanone hydrochloride can be synthesized by the reaction of 2-(methylam...

Compound Q&A

What precautions should be taken when handling 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (CAS: 879669-95-1)?

When handling 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride, it is important to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...