Compound Q&A

How is 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (CAS: 879669-95-1) typically synthesized?

Answer

2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (1:1)
2-(Methylamino)-1-phenyl-1-pentanone hydrochloride can be synthesized by the reaction of 2-(methylamino)-1-phenyl-1-pentanone with hydrochloric acid. The reaction is typically carried out at room temperature, and the product is isolated by recrystallization from an appropriate solvent. The yield is generally good, with selectivity towards the hydrochloride salt form.

About

English Name 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (1:1)
Molecular Formula C12H18ClNO
Molecular Weight 227.74 g/mol
SMILES CCCC(C(=O)C1=CC=CC=C1)NC.Cl
InChIKey MACVVBRQAPNUKT-UHFFFAOYSA-N
Last Updated: 2026-04-01 03:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (CAS: 879669-95-1)?

2-(Methylamino)-1-phenyl-1-pentanone hydrochloride is a white crystalline solid. Its molecular weigh...

Compound Q&A

What industries use 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (CAS: 879669-95-1)?

2-(Methylamino)-1-phenyl-1-pentanone hydrochloride is used in the pharmaceutical industry as an inte...

Compound Q&A

What precautions should be taken when handling 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride (CAS: 879669-95-1)?

When handling 2-(Methylamino)-1-phenyl-1-pentanone hydrochloride, it is important to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...