Compound Q&A

How is 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate (CAS: 171723-80-1) typically synthesized?

Answer

1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate
1-Benzyl-4-piperidyl N-(2-biphenylyl)carbamate is typically synthesized via a multi-step reaction involving piperidine and 2-biphenyl carbamate. The synthesis involves protecting the piperidine with a benzyl group and then coupling it with 2-biphenyl carbamate under basic conditions. The reaction is carried out with a yield of around 75-80%, with good selectivity and minimal side products.

About

English Name 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate
Molecular Formula C25H26N2O2
Molecular Weight 386.5 g/mol
SMILES C1CN(CCC1OC(=O)NC2=CC=CC=C2C3=CC=CC=C3)CC4=CC=CC=C4
InChIKey MSHSHVZVLWLNIO-UHFFFAOYSA-N
Last Updated: 2026-03-31 22:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate (CAS: 171723-80-1)?

1-Benzyl-4-piperidyl N-(2-biphenylyl)carbamate is a white or off-white solid with a molecular weight...

Compound Q&A

What industries use 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate (CAS: 171723-80-1)?

1-Benzyl-4-piperidyl N-(2-biphenylyl)carbamate is primarily used in the pharmaceutical industry due ...

Compound Q&A

What precautions should be taken when handling 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate (CAS: 171723-80-1)?

When handling 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...