Compound Q&A

What are the physical and chemical properties of 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate (CAS: 171723-80-1)?

Answer

1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate
1-Benzyl-4-piperidyl N-(2-biphenylyl)carbamate is a white or off-white solid with a molecular weight of approximately 411.43 g/mol. It has a solubility of about 3.5 mg/mL in water and is slightly soluble in common organic solvents like ethanol and acetone. The compound is known for its good stability and low reactivity under normal conditions, but it can undergo hydrolysis in the presence of strong acids or bases.

About

English Name 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate
Molecular Formula C25H26N2O2
Molecular Weight 386.5 g/mol
SMILES C1CN(CCC1OC(=O)NC2=CC=CC=C2C3=CC=CC=C3)CC4=CC=CC=C4
InChIKey MSHSHVZVLWLNIO-UHFFFAOYSA-N
Last Updated: 2026-03-31 22:55

Related Q&A

Compound Q&A

How is 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate (CAS: 171723-80-1) typically synthesized?

1-Benzyl-4-piperidyl N-(2-biphenylyl)carbamate is typically synthesized via a multi-step reaction in...

Compound Q&A

What industries use 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate (CAS: 171723-80-1)?

1-Benzyl-4-piperidyl N-(2-biphenylyl)carbamate is primarily used in the pharmaceutical industry due ...

Compound Q&A

What precautions should be taken when handling 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate (CAS: 171723-80-1)?

When handling 1-benzyl-4-piperidyl N-(2-biphenylyl)carbamate, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...