Compound Q&A

What industries use 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene (CAS: 1373864-66-4)?

Answer

1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene
1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene finds applications in the pharmaceutical and chemical industries. It is used as an intermediate in the synthesis of various compounds and has potential uses in polymer science and sensor technology due to its functional groups. Its stability and reactivity make it suitable for a range of applications in organic synthesis and material science.

About

English Name 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene
Molecular Formula C8H5ClF4O
Molecular Weight 228.57 g/mol
SMILES c1cc(c(c(c1)OC(F)(F)F)F)CCl
InChIKey RXMSLJKBPIQURI-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene (CAS: 1373864-66-4)?

1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene is a crystalline compound with a molecular wei...

Compound Q&A

How is 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene (CAS: 1373864-66-4) typically synthesized?

1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene is typically synthesized via a multi-step proc...

Compound Q&A

What precautions should be taken when handling 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene (CAS: 1373864-66-4)?

When handling 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene, it is important to use proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...