Compound Q&A

How is 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene (CAS: 1373864-66-4) typically synthesized?

Answer

1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene
1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene is typically synthesized via a multi-step process involving the chloromethylation of 2-fluoro-3-(trifluoromethoxy)benzene followed by a substitution reaction. The synthesis often uses catalytic amounts of a Lewis acid like aluminum chloride and a chloromethylating agent. The reaction conditions are carefully controlled to ensure high selectivity and yield.

About

English Name 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene
Molecular Formula C8H5ClF4O
Molecular Weight 228.57 g/mol
SMILES c1cc(c(c(c1)OC(F)(F)F)F)CCl
InChIKey RXMSLJKBPIQURI-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene (CAS: 1373864-66-4)?

1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene is a crystalline compound with a molecular wei...

Compound Q&A

What industries use 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene (CAS: 1373864-66-4)?

1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene finds applications in the pharmaceutical and c...

Compound Q&A

What precautions should be taken when handling 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene (CAS: 1373864-66-4)?

When handling 1-(Chloromethyl)-2-fluoro-3-(trifluoromethoxy)benzene, it is important to use proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...