Compound Q&A

What are the main uses of 3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7)?

Answer

3-Chloro-4,5-diethoxybenzoic acid
3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) is primarily used as an intermediate in the pharmaceutical industry for the synthesis of various drugs. It also finds applications in research as a reagent and in the production of certain organic compounds. Its use in the food industry is limited due to regulatory restrictions on the use of chlorinated compounds.

About

English Name 3-Chloro-4,5-diethoxybenzoic acid
Molecular Formula C11H13ClO4
Molecular Weight 244.67 g/mol
SMILES CCOc1cc(cc(c1OCC)Cl)C(=O)O
InChIKey MEADRIRYKFSBDO-UHFFFAOYSA-N
Last Updated: 2026-03-31 00:17

Related Q&A

Compound Q&A

What is 3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7)?

3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) is a white crystalline solid. It has a molecula...

Compound Q&A

Is 3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) safe?

3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) is generally considered safe when used under pr...

Compound Q&A

How should 3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) be stored?

3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) should be stored in a cool, dry place, away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...