Compound Q&A

What is 3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7)?

Answer

3-Chloro-4,5-diethoxybenzoic acid
3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) is a white crystalline solid. It has a molecular formula of C11H14ClO4 and a molecular weight of 262.63 g/mol. This compound is characterized by its ability to dissolve in water and organic solvents, and it is commonly used in the synthesis of pharmaceuticals and other applications due to its chemical reactivity.

About

English Name 3-Chloro-4,5-diethoxybenzoic acid
Molecular Formula C11H13ClO4
Molecular Weight 244.67 g/mol
SMILES CCOc1cc(cc(c1OCC)Cl)C(=O)O
InChIKey MEADRIRYKFSBDO-UHFFFAOYSA-N
Last Updated: 2026-03-31 00:17

Related Q&A

Compound Q&A

What are the main uses of 3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7)?

3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) is primarily used as an intermediate in the pha...

Compound Q&A

Is 3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) safe?

3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) is generally considered safe when used under pr...

Compound Q&A

How should 3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) be stored?

3-Chloro-4,5-diethoxybenzoic acid (CAS: 766523-19-7) should be stored in a cool, dry place, away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...