Compound Q&A

Is (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid (CAS: 90139-06-3) safe?

Answer

(1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid
Safety depends on usage context. This compound is generally safe when used under controlled laboratory conditions and with appropriate handling procedures. However, it should be handled with caution due to its chemical complexity and potential reactivity. Adequate protective gear and safety protocols are recommended.

About

CAS No 90139-06-3
English Name (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid
Molecular Formula C20H27N3O5
Molecular Weight 389.45 g/mol
SMILES C1CC(C(=O)N2C(CCCN2C1)C(=O)O)NC(CCC3=CC=CC=C3)C(=O)O
InChIKey UVAUYSRYXACKSC-ULQDDVLXSA-N
Last Updated: 2026-03-31 00:17

Related Q&A

Compound Q&A

What is (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid (CAS: 90139-06-3)?

This compound is a complex organic molecule with a unique structure, including a pyridazino[1,2-a][1...

Compound Q&A

What are the main uses of (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid (CAS: 90139-06-3)?

The compound is primarily used in the research and development of new drugs, particularly in the inv...

Compound Q&A

How should (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid (CAS: 90139-06-3) be stored?

Store in a tightly sealed container at room temperature (15-25°C), away from direct sunlight and moi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...