Compound Q&A

What is (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid (CAS: 90139-06-3)?

Answer

(1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid
This compound is a complex organic molecule with a unique structure, including a pyridazino[1,2-a][1,2]diazepine core with additional functional groups such as amino and carboxylic acid. It is a research chemical with potential applications in medicinal chemistry and drug development.

About

CAS No 90139-06-3
English Name (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid
Molecular Formula C20H27N3O5
Molecular Weight 389.45 g/mol
SMILES C1CC(C(=O)N2C(CCCN2C1)C(=O)O)NC(CCC3=CC=CC=C3)C(=O)O
InChIKey UVAUYSRYXACKSC-ULQDDVLXSA-N
Last Updated: 2026-03-31 00:17

Related Q&A

Compound Q&A

What are the main uses of (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid (CAS: 90139-06-3)?

The compound is primarily used in the research and development of new drugs, particularly in the inv...

Compound Q&A

Is (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid (CAS: 90139-06-3) safe?

Safety depends on usage context. This compound is generally safe when used under controlled laborato...

Compound Q&A

How should (1S,9S)-9-{[(1S)-1-Carboxy-3-phenylpropyl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid (CAS: 90139-06-3) be stored?

Store in a tightly sealed container at room temperature (15-25°C), away from direct sunlight and moi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...