Compound Q&A

Is 1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) safe?

Answer

1,3,6-Naphthalenetrisulfonic acid
1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) is generally considered safe for laboratory use when proper precautions are taken. However, it should be handled with care due to its potential skin and eye irritation. Protective gloves and safety goggles are recommended.

About

CAS No 86-66-8
English Name 1,3,6-Naphthalenetrisulfonic acid
Molecular Formula C10H8O9S3
Molecular Weight 368.37 g/mol
EINECS 201-690-8
SMILES OS(=O)(=O)c1ccc2c(cc(cc2c1)S(=O)(=O)O)S(=O)(=O)O
InChIKey ZPBSAMLXSQCSOX-UHFFFAOYSA-N
Last Updated: 2026-03-30 20:33

Related Q&A

Compound Q&A

What is 1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8)?

1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) is a trisulfonic acid derivative of naphthalene. It...

Compound Q&A

What are the main uses of 1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8)?

1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) is primarily used as a pH indicator in titrations a...

Compound Q&A

How should 1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) be stored?

1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) should be stored in a cool, dry place away from dir...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...