Compound Q&A

What is 1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8)?

Answer

1,3,6-Naphthalenetrisulfonic acid
1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) is a trisulfonic acid derivative of naphthalene. It is a yellow crystalline solid with a high melting point and is often used as a pH indicator or in analytical chemistry for titration purposes.

About

CAS No 86-66-8
English Name 1,3,6-Naphthalenetrisulfonic acid
Molecular Formula C10H8O9S3
Molecular Weight 368.37 g/mol
EINECS 201-690-8
SMILES OS(=O)(=O)c1ccc2c(cc(cc2c1)S(=O)(=O)O)S(=O)(=O)O
InChIKey ZPBSAMLXSQCSOX-UHFFFAOYSA-N
Last Updated: 2026-03-30 20:33

Related Q&A

Compound Q&A

What are the main uses of 1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8)?

1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) is primarily used as a pH indicator in titrations a...

Compound Q&A

Is 1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) safe?

1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) is generally considered safe for laboratory use whe...

Compound Q&A

How should 1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) be stored?

1,3,6-Naphthalenetrisulfonic acid (CAS: 86-66-8) should be stored in a cool, dry place away from dir...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...