Compound Q&A

What is the market or research trend for Boc-3-aminoadipic acid (CAS: 1185301-26-1)?

Answer

Boc-3-aminoadipic acid
The market for Boc-3-aminoadipic acid (CAS: 1185301-26-1) is growing due to its applications in the synthesis of peptides and pharmaceuticals. Research trends indicate increasing interest in its use in developing novel drug candidates and therapeutic peptides. Additionally, the trend towards sustainability and green chemistry is driving the search for environmentally friendly synthesis methods.

About

English Name Boc-3-aminoadipic acid
Molecular Formula C11H19NO6
Molecular Weight 261.27 g/mol
SMILES CC(C)(C)OC(=O)NC(CCC(=O)O)CC(=O)O
InChIKey BWZYMMYMEYGJOL-UHFFFAOYSA-N
Last Updated: 2026-03-29 16:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to Boc-3-aminoadipic acid (CAS: 1185301-26-1)?

Boc-3-aminoadipic acid (CAS: 1185301-26-1) falls under the scope of various regulatory guidelines in...

Compound Q&A

Are there alternatives to Boc-3-aminoadipic acid in synthesis (CAS: 1185301-26-1)?

Alternative reagents to Boc-3-aminoadipic acid include other amino acids such as Boc-2-aminoadipic a...

Compound Q&A

How should waste containing Boc-3-aminoadipic acid (CAS: 1185301-26-1) be handled?

Waste containing Boc-3-aminoadipic acid (CAS: 1185301-26-1) should be collected in appropriate conta...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...