Compound Q&A

What industries use Unii-92C8wzz28Z (CAS: 86108-27-2)?

Answer

Unii-92C8wzz28Z
Unii-92C8wzz28Z (CAS: 86108-27-2) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry for the modification of polymer properties. Additionally, the compound is used in the production of sensors and semiconductors due to its unique physical and chemical properties.

About

CAS No 86108-27-2
English Name Unii-92C8wzz28Z
Molecular Formula C17H22N4O12P2
Molecular Weight 536.32 g/mol
SMILES P(=O)(O)(O)O[C@H]([C@@H](CO)OP(=O)(O)O)[C@H](CN1C2C(C(NC(N=2)=O)=O)=NC2C=C(C)C(C)=CC1=2)O
InChIKey TZDBHGNYCSWJOP-SCRDCRAPSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Unii-92C8wzz28Z (CAS: 86108-27-2)?

Unii-92C8wzz28Z (CAS: 86108-27-2) is a colorless to light yellow liquid with a molecular weight of a...

Compound Q&A

How is Unii-92C8wzz28Z (CAS: 86108-27-2) typically synthesized?

Unii-92C8wzz28Z (CAS: 86108-27-2) can be synthesized via the condensation of acetic anhydride with d...

Compound Q&A

What precautions should be taken when handling Unii-92C8wzz28Z (CAS: 86108-27-2)?

When handling Unii-92C8wzz28Z (CAS: 86108-27-2), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...