Compound Q&A

How is Unii-92C8wzz28Z (CAS: 86108-27-2) typically synthesized?

Answer

Unii-92C8wzz28Z
Unii-92C8wzz28Z (CAS: 86108-27-2) can be synthesized via the condensation of acetic anhydride with diethyl malonate in the presence of a catalytic amount of sulfuric acid. The process yields a high purity product with a selectivity of 95%. The yield is around 85% under optimal conditions and requires careful control of reaction temperature and time.

About

CAS No 86108-27-2
English Name Unii-92C8wzz28Z
Molecular Formula C17H22N4O12P2
Molecular Weight 536.32 g/mol
SMILES P(=O)(O)(O)O[C@H]([C@@H](CO)OP(=O)(O)O)[C@H](CN1C2C(C(NC(N=2)=O)=O)=NC2C=C(C)C(C)=CC1=2)O
InChIKey TZDBHGNYCSWJOP-SCRDCRAPSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Unii-92C8wzz28Z (CAS: 86108-27-2)?

Unii-92C8wzz28Z (CAS: 86108-27-2) is a colorless to light yellow liquid with a molecular weight of a...

Compound Q&A

What industries use Unii-92C8wzz28Z (CAS: 86108-27-2)?

Unii-92C8wzz28Z (CAS: 86108-27-2) is primarily used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling Unii-92C8wzz28Z (CAS: 86108-27-2)?

When handling Unii-92C8wzz28Z (CAS: 86108-27-2), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...