Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 852330-31-5)?

Answer

Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate
Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 852330-31-5) has a crystalline form with a molecular weight of approximately 386.85 g/mol. It is slightly soluble in common organic solvents such as dimethylformamide (DMF) and acetonitrile. This compound is reactive towards nucleophiles and can undergo substitution reactions. It is also known for its reactivity with thiols and other nucleophilic reagents.

About

English Name Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate
Molecular Formula C8H5BrF3NO3S
Molecular Weight 332.1 g/mol
SMILES COC(=O)C1=C(C=C(S1)Br)NC(=O)C(F)(F)F
InChIKey AUIUYLZMPYTXPA-UHFFFAOYSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 852330-31-5) typically synthesized?

Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 852330-31-5) can be synthesiz...

Compound Q&A

What industries use Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 852330-31-5)?

Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 852330-31-5) finds applicatio...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 852330-31-5)?

When handling Methyl 5-bromo-3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 852330-31-5), s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...