Compound Q&A

What precautions should be taken when handling Dipyrido[3,2-c:2',3'-e]pyridazine (CAS: 653-05-4)?

Answer

Dipyrido[3,2-c:2',3'-e]pyridazine
When handling Dipyrido[3,2-c:2',3'-e]pyridazine (CAS: 653-05-4), it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a chemical fume hood due to its volatility and potential for inhalation. Spills should be cleaned up immediately using an appropriate absorbent material, and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for detailed handling and storage instructions.

About

CAS No 653-05-4
English Name Dipyrido[3,2-c:2',3'-e]pyridazine
Molecular Formula C10H6N4
Molecular Weight 182.19 g/mol
SMILES C1=CC2=C(C3=C(C=CC=N3)N=N2)N=C1
InChIKey QMFMZFPFIUREDE-UHFFFAOYSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dipyrido[3,2-c:2',3'-e]pyridazine (CAS: 653-05-4)?

Dipyrido[3,2-c:2',3'-e]pyridazine (CAS: 653-05-4) is a solid compound. Its molecular weight is appro...

Compound Q&A

How is Dipyrido[3,2-c:2',3'-e]pyridazine (CAS: 653-05-4) typically synthesized?

Dipyrido[3,2-c:2',3'-e]pyridazine (CAS: 653-05-4) is typically synthesized through a multistep react...

Compound Q&A

What industries use Dipyrido[3,2-c:2',3'-e]pyridazine (CAS: 653-05-4)?

Dipyrido[3,2-c:2',3'-e]pyridazine (CAS: 653-05-4) is used in various industries. It is a key interme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...