Compound Q&A

What are the physical and chemical properties of Ranatachykinin A (CAS: 135690-47-0)?

Answer

Ranatachykinin A
Ranatachykinin A (CAS: 135690-47-0) is a cyclic decapeptide with a molecular weight of approximately 1241.45 Da. It is highly soluble in water and has a crystalline form with a melting point around 220°C. It is stable in acidic and basic conditions but can degrade upon exposure to light and heat.

About

English Name Ranatachykinin A
Molecular Formula C60H92N16O15S
Molecular Weight 1309.5 g/mol
SMILES CC(C)CC(C(=O)NC(CCSC)C(=O)N)NC(=O)CNC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(=O)O)NC(=O)C3CCCN3C(=O)C(CO)NC(=O)C4CCCN4C(=O)C(CCCCN)N
InChIKey CBWGJMUZXSIZFG-CIRMSXBNSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

How is Ranatachykinin A (CAS: 135690-47-0) typically synthesized?

Ranatachykinin A (CAS: 135690-47-0) is synthesized through solid-phase peptide synthesis (SPPS) usin...

Compound Q&A

What industries use Ranatachykinin A (CAS: 135690-47-0)?

Ranatachykinin A (CAS: 135690-47-0) is primarily used in pharmaceutical research for its potential a...

Compound Q&A

What precautions should be taken when handling Ranatachykinin A (CAS: 135690-47-0)?

When handling Ranatachykinin A (CAS: 135690-47-0), laboratory personnel should wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...