Compound Q&A

How is Adrenaline EP Impurity D (CAS: 317351-40-9) typically synthesized?

Answer

Adrenaline EP Impurity D
Adrenaline EP Impurity D (CAS: 317351-40-9) is typically synthesized through a multistep process involving bromination of a precursor compound, followed by several redox reactions. Common catalysts include iron(III) chloride and sodium hypochlorite. The process has a moderate yield, with careful control of reaction conditions to ensure high selectivity.

About

English Name Adrenaline EP Impurity D
Molecular Formula C16H19NO3
Molecular Weight 273.33 g/mol
SMILES Oc1ccc(cc1O)[C@@H](O)CN(Cc2ccccc2)C
InChIKey YENHZTNWVCNPRW-INIZCTEOSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of Adrenaline EP Impurity D (CAS: 317351-40-9)?

Adrenaline EP Impurity D (CAS: 317351-40-9) is a crystalline compound with a molecular weight of app...

Compound Q&A

What industries use Adrenaline EP Impurity D (CAS: 317351-40-9)?

Adrenaline EP Impurity D (CAS: 317351-40-9) is primarily used in the pharmaceutical industry for qua...

Compound Q&A

What precautions should be taken when handling Adrenaline EP Impurity D (CAS: 317351-40-9)?

When handling Adrenaline EP Impurity D (CAS: 317351-40-9), it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...