Compound Q&A

What are the physical and chemical properties of Adrenaline EP Impurity D (CAS: 317351-40-9)?

Answer

Adrenaline EP Impurity D
Adrenaline EP Impurity D (CAS: 317351-40-9) is a crystalline compound with a molecular weight of approximately 183.17 g/mol. It is slightly soluble in water and ethanol. Chemically, it is highly reactive under acidic conditions and less so under basic conditions. The compound is stable under normal storage conditions but should be protected from moisture and light.

About

English Name Adrenaline EP Impurity D
Molecular Formula C16H19NO3
Molecular Weight 273.33 g/mol
SMILES Oc1ccc(cc1O)[C@@H](O)CN(Cc2ccccc2)C
InChIKey YENHZTNWVCNPRW-INIZCTEOSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

How is Adrenaline EP Impurity D (CAS: 317351-40-9) typically synthesized?

Adrenaline EP Impurity D (CAS: 317351-40-9) is typically synthesized through a multistep process inv...

Compound Q&A

What industries use Adrenaline EP Impurity D (CAS: 317351-40-9)?

Adrenaline EP Impurity D (CAS: 317351-40-9) is primarily used in the pharmaceutical industry for qua...

Compound Q&A

What precautions should be taken when handling Adrenaline EP Impurity D (CAS: 317351-40-9)?

When handling Adrenaline EP Impurity D (CAS: 317351-40-9), it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...