Compound Q&A

What industries use 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid (CAS: 849353-56-6)?

Answer

3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid
3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid is used in the pharmaceutical industry for the synthesis of drug intermediates. It is also applied in polymer synthesis and as a precursor in the development of sensors and semiconductors. Its versatility and specific functional groups make it valuable in these industries.

About

English Name 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid
Molecular Formula C12H15FO2
Molecular Weight 210.25 g/mol
SMILES CC1=C(C=C(C=C1)F)C(C)(C)CC(=O)O
InChIKey DCCLHALCAVPUCC-UHFFFAOYSA-N
Last Updated: 2026-03-28 23:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid (CAS: 849353-56-6)?

3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid is a solid with a crystalline form. Its molecular ...

Compound Q&A

How is 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid (CAS: 849353-56-6) typically synthesized?

3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid is synthesized via a multi-step process involving ...

Compound Q&A

What precautions should be taken when handling 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid (CAS: 849353-56-6)?

When handling 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid, appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...