Compound Q&A

What are the physical and chemical properties of 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid (CAS: 849353-56-6)?

Answer

3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid
3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid is a solid with a crystalline form. Its molecular weight is approximately 243.2 g/mol. It has a low water solubility, making it suitable for organic synthesis and pharmaceutical applications. The compound is relatively stable in air but may react with strong bases. It is used in the synthesis of pharmaceuticals and other organic compounds.

About

English Name 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid
Molecular Formula C12H15FO2
Molecular Weight 210.25 g/mol
SMILES CC1=C(C=C(C=C1)F)C(C)(C)CC(=O)O
InChIKey DCCLHALCAVPUCC-UHFFFAOYSA-N
Last Updated: 2026-03-28 23:48

Related Q&A

Compound Q&A

How is 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid (CAS: 849353-56-6) typically synthesized?

3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid is synthesized via a multi-step process involving ...

Compound Q&A

What industries use 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid (CAS: 849353-56-6)?

3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid is used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid (CAS: 849353-56-6)?

When handling 3-(5-Fluoro-2-methylphenyl)-3-methylbutanoic acid, appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...