Compound Q&A

What industries use 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7)?

Answer

2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid
2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid is used in the pharmaceutical industry for the synthesis of bioactive molecules and in the polymer industry for the modification of polymer properties. It also finds applications in the development of sensors and semiconductors due to its unique chemical structure.

About

English Name 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid
Molecular Formula C12H15NO2
Molecular Weight 205.25699999999998 g/mol
SMILES CC(C(=O)O)N1CCC2=CC=CC=C2C1
InChIKey WBBXROBGMOSNAC-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7)?

2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid has a crystalline form with a molecular weight of ...

Compound Q&A

How is 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7) typically synthesized?

2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid can be synthesized through a multi-step process in...

Compound Q&A

What precautions should be taken when handling 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7)?

Proper personal protective equipment (PPE) should be worn when handling 2-(3,4-Dihydro-2(1H)-isoquin...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...